CAS 1110820-18-2 appears in our catalog under these names: 1-([5-(Chloromethyl)-2-furyl]sulfonyl)pyrrolidine, 95%, 1-{(5-(Chloromethyl)furan-2-yl)sulfonyl}pyrrolidine, 1-{(5-(chloromethyl)furan-2-yl)sulfonyl}pyrrolidine, 95%. Offered by: Combi-blocks, Biosynth, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
1-[5-(chloromethyl)furan-2-yl]sulfonylpyrrolidine (CAS 1110820-18-2) is a chemical compound with the molecular formula C9H12ClNO3S and a molecular weight of 249.72 g/mol. IUPAC name: 1-[5-(chloromethyl)furan-2-yl]sulfonylpyrrolidine. InChIKey: ITIWKPRYBBDOPP-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3S |
|---|---|
| Molecular weight | 249.72 g/mol |
| IUPAC name | 1-[5-(chloromethyl)furan-2-yl]sulfonylpyrrolidine |
| InChIKey | ITIWKPRYBBDOPP-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC=C(O2)CCl |
Computed by PubChem (NCBI)