CAS 1566806-96-9 appears in our catalog under these names: 6-(tert-Butoxy)pyridine-3-sulfonyl chloride, 95%, 6-(tert-Butoxy)pyridine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-[(2-methylpropan-2-yl)oxy]pyridine-3-sulfonyl chloride (CAS 1566806-96-9) is a chemical compound with the molecular formula C9H12ClNO3S and a molecular weight of 249.72 g/mol. IUPAC name: 6-[(2-methylpropan-2-yl)oxy]pyridine-3-sulfonyl chloride. InChIKey: IVZCUSZEYATXTK-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3S |
|---|---|
| Molecular weight | 249.72 g/mol |
| IUPAC name | 6-[(2-methylpropan-2-yl)oxy]pyridine-3-sulfonyl chloride |
| InChIKey | IVZCUSZEYATXTK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=NC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)