CAS 1111102-49-8 is the registry number for 2-(2-aminopyrimidin-5-yl)phenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-(2-aminopyrimidin-5-yl)phenol (CAS 1111102-49-8) is a chemical compound with the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. IUPAC name: 2-(2-aminopyrimidin-5-yl)phenol. InChIKey: KNAALOCBRABLKM-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | 2-(2-aminopyrimidin-5-yl)phenol |
| InChIKey | KNAALOCBRABLKM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CN=C(N=C2)N)O |
Computed by PubChem (NCBI)