CAS 1111104-91-6 is the registry number for 5-(furan-2-yl)pyrimidin-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
5-(furan-2-yl)pyrimidin-2-amine (CAS 1111104-91-6) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 5-(furan-2-yl)pyrimidin-2-amine. InChIKey: LYRIRVVVMRHKOF-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 5-(furan-2-yl)pyrimidin-2-amine |
| InChIKey | LYRIRVVVMRHKOF-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CN=C(N=C2)N |
Computed by PubChem (NCBI)