CAS 1111105-03-3 is the registry number for 5-[4-(Trifluoromethoxy)phenyl]pyrimidin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
5-[4-(trifluoromethoxy)phenyl]pyrimidin-2-amine (CAS 1111105-03-3) is a chemical compound with the molecular formula C11H8F3N3O and a molecular weight of 255.20 g/mol. IUPAC name: 5-[4-(trifluoromethoxy)phenyl]pyrimidin-2-amine. InChIKey: LAKCMOIDDWOAHA-UHFFFAOYSA-N.
| Molecular formula | C11H8F3N3O |
|---|---|
| Molecular weight | 255.20 g/mol |
| IUPAC name | 5-[4-(trifluoromethoxy)phenyl]pyrimidin-2-amine |
| InChIKey | LAKCMOIDDWOAHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(N=C2)N)OC(F)(F)F |
Computed by PubChem (NCBI)