CAS 1185292-58-3 is the registry number for 2-(Trifluoromethyl)quinoline-4-carbohydrazide, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
2-(trifluoromethyl)quinoline-4-carbohydrazide (CAS 1185292-58-3) is a chemical compound with the molecular formula C11H8F3N3O and a molecular weight of 255.20 g/mol. IUPAC name: 2-(trifluoromethyl)quinoline-4-carbohydrazide. InChIKey: NXIBPYSMTAAEDI-UHFFFAOYSA-N.
| Molecular formula | C11H8F3N3O |
|---|---|
| Molecular weight | 255.20 g/mol |
| IUPAC name | 2-(trifluoromethyl)quinoline-4-carbohydrazide |
| InChIKey | NXIBPYSMTAAEDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C(F)(F)F)C(=O)NN |
Computed by PubChem (NCBI)