CAS 1111106-00-3 is the registry number for 5-(2,6-Dimethylphenyl)pyridin-2-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(2,6-dimethylphenyl)-1H-pyridin-2-one (CAS 1111106-00-3) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 5-(2,6-dimethylphenyl)-1H-pyridin-2-one. InChIKey: GSYUKOCUQQXADF-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 5-(2,6-dimethylphenyl)-1H-pyridin-2-one |
| InChIKey | GSYUKOCUQQXADF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C2=CNC(=O)C=C2 |
Computed by PubChem (NCBI)