Products 111157-50-7
CAS 111157-50-7 is the registry number for (E)-Ethyl 3-(1-trityl-1h-imidazol-4-yl)acrylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Ethyl (E)-3-(1-tritylimidazol-4-yl)prop-2-enoate (CAS 111157-50-7) is a chemical compound with the molecular formula C27H24N2O2 and a molecular weight of 408.5 g/mol. IUPAC name: ethyl (E)-3-(1-tritylimidazol-4-yl)prop-2-enoate. InChIKey: VWIZYQXKZWPEES-VHEBQXMUSA-N.
| Molecular formula | C27H24N2O2 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | ethyl (E)-3-(1-tritylimidazol-4-yl)prop-2-enoate |
| InChIKey | VWIZYQXKZWPEES-VHEBQXMUSA-N |
| SMILES | CCOC(=O)/C=C/C1=CN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)