Products 1448711-61-2
CAS 1448711-61-2 is the registry number for PI3Kα-IN-16. Offered by: MedChemExpress. Available pack sizes: Get quote.
Propan-2-yl 9-ethyl-1-naphthalen-1-ylpyrido[3,4-b]indole-3-carboxylate (CAS 1448711-61-2) is a chemical compound with the molecular formula C27H24N2O2 and a molecular weight of 408.5 g/mol. IUPAC name: propan-2-yl 9-ethyl-1-naphthalen-1-ylpyrido[3,4-b]indole-3-carboxylate. InChIKey: CCPVJNGJNZLMDG-UHFFFAOYSA-N.
| Molecular formula | C27H24N2O2 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | propan-2-yl 9-ethyl-1-naphthalen-1-ylpyrido[3,4-b]indole-3-carboxylate |
| InChIKey | CCPVJNGJNZLMDG-UHFFFAOYSA-N |
| SMILES | CCN1C2=CC=CC=C2C3=CC(=NC(=C31)C4=CC=CC5=CC=CC=C54)C(=O)OC(C)C |
Computed by PubChem (NCBI)