Products 111198-55-1
CAS 111198-55-1 is the registry number for Mitiglinide Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-benzyl-4-methoxy-4-oxobutanoic acid (CAS 111198-55-1) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: (2S)-2-benzyl-4-methoxy-4-oxobutanoic acid. InChIKey: IEHZYEQBSQBULK-JTQLQIEISA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (2S)-2-benzyl-4-methoxy-4-oxobutanoic acid |
| InChIKey | IEHZYEQBSQBULK-JTQLQIEISA-N |
| SMILES | COC(=O)C[C@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Mitiglinide Calcium Impurity 12