CAS 1112209-40-1 appears in our catalog under these names: 2-Fluoro-3-formylphenylboronic acid, pinacol ester, 98%, 2-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde 98%, 2-Fluoro-3-formylphenylboronic acid, pinacol ester, 98%, 98%, 2-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1112209-40-1) is a chemical compound with the molecular formula C13H16BFO3 and a molecular weight of 250.08 g/mol. IUPAC name: 2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: IFIDGFJKIAHLAQ-UHFFFAOYSA-N.
| Molecular formula | C13H16BFO3 |
|---|---|
| Molecular weight | 250.08 g/mol |
| IUPAC name | 2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | IFIDGFJKIAHLAQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C=O)F |
Computed by PubChem (NCBI)