CAS 443776-94-1 appears in our catalog under these names: 4-Fluoro-3-formylphenylboronic acid, pinacol ester, 97%, 4–Fluoro–3–formylbenzeneboronic acid pinacol ester, 2-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde 98%, 4-Fluoro-3-formylphenylboronic acid, pinacol ester, 95%, 95%, 2-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 443776-94-1) is a chemical compound with the molecular formula C13H16BFO3 and a molecular weight of 250.08 g/mol. IUPAC name: 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: RRKWTJBMMUWQDK-UHFFFAOYSA-N.
| Molecular formula | C13H16BFO3 |
|---|---|
| Molecular weight | 250.08 g/mol |
| IUPAC name | 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | RRKWTJBMMUWQDK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)C=O |
Computed by PubChem (NCBI)