Products 111252-98-3
CAS 111252-98-3 is the registry number for (2E)-3-(5-Chlorofuran-2-yl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(E)-3-(5-chlorofuran-2-yl)prop-2-enoic acid (CAS 111252-98-3) is a chemical compound with the molecular formula C7H5ClO3 and a molecular weight of 172.56 g/mol. IUPAC name: (E)-3-(5-chlorofuran-2-yl)prop-2-enoic acid. InChIKey: RVLDLKQBAJBUGU-DUXPYHPUSA-N.
| Molecular formula | C7H5ClO3 |
|---|---|
| Molecular weight | 172.56 g/mol |
| IUPAC name | (E)-3-(5-chlorofuran-2-yl)prop-2-enoic acid |
| InChIKey | RVLDLKQBAJBUGU-DUXPYHPUSA-N |
| SMILES | C1=C(OC(=C1)Cl)/C=C/C(=O)O |
Computed by PubChem (NCBI)