CAS 1112526-42-7 is the registry number for tert-Butyl 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1112526-42-7) is a chemical compound with the molecular formula C18H27BO5 and a molecular weight of 334.2 g/mol. IUPAC name: tert-butyl 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: BCAUFTRJYMCEIO-UHFFFAOYSA-N.
| Molecular formula | C18H27BO5 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | tert-butyl 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | BCAUFTRJYMCEIO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)