Products 1218789-66-2

CAS 1218789-66-2 is the registry number for 3-Butoxy-5-(methoxycarbonyl)phenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-butoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1218789-66-2) is a chemical compound with the molecular formula C18H27BO5 and a molecular weight of 334.2 g/mol. IUPAC name: methyl 3-butoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: YVQOJFRMGGKLDD-UHFFFAOYSA-N.

Identity
Molecular formulaC18H27BO5
Molecular weight334.2 g/mol
IUPAC namemethyl 3-butoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate
InChIKeyYVQOJFRMGGKLDD-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OCCCC)C(=O)OC

Computed by PubChem (NCBI)