CAS 1218789-66-2 is the registry number for 3-Butoxy-5-(methoxycarbonyl)phenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 3-butoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1218789-66-2) is a chemical compound with the molecular formula C18H27BO5 and a molecular weight of 334.2 g/mol. IUPAC name: methyl 3-butoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: YVQOJFRMGGKLDD-UHFFFAOYSA-N.
| Molecular formula | C18H27BO5 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | methyl 3-butoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | YVQOJFRMGGKLDD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OCCCC)C(=O)OC |
Computed by PubChem (NCBI)