Products 111258-00-5
CAS 111258-00-5 is the registry number for Cpa 1 hydrate. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
[1]benzofuro[6,5-e][1]benzofuran-2,8-dicarboxylic acid (CAS 111258-00-5) is a chemical compound with the molecular formula C16H8O6 and a molecular weight of 296.23 g/mol. IUPAC name: [1]benzofuro[6,5-e][1]benzofuran-2,8-dicarboxylic acid. InChIKey: IPFSIVVOJSEJOL-UHFFFAOYSA-N.
| Molecular formula | C16H8O6 |
|---|---|
| Molecular weight | 296.23 g/mol |
| IUPAC name | [1]benzofuro[6,5-e][1]benzofuran-2,8-dicarboxylic acid |
| InChIKey | IPFSIVVOJSEJOL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(O2)C(=O)O)C3=CC4=C(C=C31)C=C(O4)C(=O)O |
Computed by PubChem (NCBI)