CAS 27485-15-0 appears in our catalog under these names: Anthraquinone-2,3-dicarboxylic acid, 98%, 2,3-Anthraquinonedicarboxylic Acid, 2,3–Anthraquinonedicarboxylic Acid, Anthraquinone-2,3-dicarboxylic Acid, >98.0%(HPLC)(T), 9,10-Dioxo-9,10-dihydroanthracene-2,3-dicarboxylic acid 95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 250mg, 1g, 5g, 100mg, 50mg, 500mg, 1000mg.
9,10-dioxoanthracene-2,3-dicarboxylic acid (CAS 27485-15-0) is a chemical compound with the molecular formula C16H8O6 and a molecular weight of 296.23 g/mol. IUPAC name: 9,10-dioxoanthracene-2,3-dicarboxylic acid. InChIKey: PSHVQIKBLXBIQJ-UHFFFAOYSA-N.
| Molecular formula | C16H8O6 |
|---|---|
| Molecular weight | 296.23 g/mol |
| IUPAC name | 9,10-dioxoanthracene-2,3-dicarboxylic acid |
| InChIKey | PSHVQIKBLXBIQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C=C3C2=O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)