CAS 42946-19-0 appears in our catalog under these names: 9,10-Dioxo-9,10-Dihydro-Anthracene-2,6-Dicarboxylic Acid, 9,10-Dioxo-9,10-dihydroanthracene-2,6-dicarboxylic acid 97%, 9,10-Dioxo-9,10-dihydroanthracene-2,6-dicarboxylic acid, 97%, 97%, 9,10-Dioxo-9,10-dihydro-anthracene-2,6-dicarboxylic acid, 97%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g.
9,10-dioxoanthracene-2,6-dicarboxylic acid (CAS 42946-19-0) is a chemical compound with the molecular formula C16H8O6 and a molecular weight of 296.23 g/mol. IUPAC name: 9,10-dioxoanthracene-2,6-dicarboxylic acid. InChIKey: ZUTFCPOKQHJATC-UHFFFAOYSA-N.
| Molecular formula | C16H8O6 |
|---|---|
| Molecular weight | 296.23 g/mol |
| IUPAC name | 9,10-dioxoanthracene-2,6-dicarboxylic acid |
| InChIKey | ZUTFCPOKQHJATC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)