CAS 111272-66-3 is the registry number for N-(4-(Benzo[d]thiazol-2-yl)phenyl)-4-methoxybenzamide. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-methoxybenzamide (CAS 111272-66-3) is a chemical compound with the molecular formula C21H16N2O2S and a molecular weight of 360.4 g/mol. IUPAC name: N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-methoxybenzamide. InChIKey: DELVZQQIUARMNW-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O2S |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-4-methoxybenzamide |
| InChIKey | DELVZQQIUARMNW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)C3=NC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)