CAS 14513-15-6 appears in our catalog under these names: Cambinol, 95%, SIRT1/2 Inhibitor IV, Cambinol, Cambinol/ 98.47% (existing batch purity), SIRT1/2 Inhibitor IV, Cambinol, >98.0%(HPLC). Offered by: Combi-blocks, TRC, TargetMol, GLPBio, TCI. Available pack sizes: 25mg, 5mg, 10mg, 1mg, 2mg, 50mg, 100mg, 500mg.
5-[(2-hydroxynaphthalen-1-yl)methyl]-6-phenyl-2-sulfanylidene-1H-pyrimidin-4-one (CAS 14513-15-6) is a chemical compound with the molecular formula C21H16N2O2S and a molecular weight of 360.4 g/mol. IUPAC name: 5-[(2-hydroxynaphthalen-1-yl)methyl]-6-phenyl-2-sulfanylidene-1H-pyrimidin-4-one. InChIKey: RVNSQVIUFZVNAU-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O2S |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 5-[(2-hydroxynaphthalen-1-yl)methyl]-6-phenyl-2-sulfanylidene-1H-pyrimidin-4-one |
| InChIKey | RVNSQVIUFZVNAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC(=S)N2)CC3=C(C=CC4=CC=CC=C43)O |
Computed by PubChem (NCBI)