CAS 111283-90-0 appears in our catalog under these names: 4-Bromo-3-thiophenesulfonyl chloride, 95%, 4-Bromo-3-thiophenesulfonyl Chloride, Technical grade. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg, 100mg, 500mg.
4-bromothiophene-3-sulfonyl chloride (CAS 111283-90-0) is a chemical compound with the molecular formula C4H2BrClO2S2 and a molecular weight of 261.5 g/mol. IUPAC name: 4-bromothiophene-3-sulfonyl chloride. InChIKey: XQOPBRYPDVISQI-UHFFFAOYSA-N.
| Molecular formula | C4H2BrClO2S2 |
|---|---|
| Molecular weight | 261.5 g/mol |
| IUPAC name | 4-bromothiophene-3-sulfonyl chloride |
| InChIKey | XQOPBRYPDVISQI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CS1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)