Products 185329-76-4

CAS 185329-76-4 appears in our catalog under these names: 4-Bromothiophene-2-sulfonyl chloride, 97%, 4-Bromothiophene-2-sulfonyl chloride, 97%, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 25mg, 50mg, 100mg, 500mg.

Structural formula: {0} (CAS {1})

4-bromothiophene-2-sulfonyl chloride (CAS 185329-76-4) is a chemical compound with the molecular formula C4H2BrClO2S2 and a molecular weight of 261.5 g/mol. IUPAC name: 4-bromothiophene-2-sulfonyl chloride. InChIKey: IMVRMHNCGCAEES-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2BrClO2S2
Molecular weight261.5 g/mol
IUPAC name4-bromothiophene-2-sulfonyl chloride
InChIKeyIMVRMHNCGCAEES-UHFFFAOYSA-N
SMILESC1=C(SC=C1Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)