Products 111291-97-5
CAS 111291-97-5 appears in our catalog under these names: tert-Butyl 4-ethynylbenzoate, 97%, 97%, tert-Butyl 4-ethynylbenzoate 97%, tert-Butyl 4-ethynylbenzoate, 97%, tert–Butyl 4–ethynylbenzoate. Offered by: Chemat, Ambeed, Fluorochem, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
Tert-butyl 4-ethynylbenzoate (CAS 111291-97-5) is a chemical compound with the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl 4-ethynylbenzoate. InChIKey: FWAUARVBLKIMRS-UHFFFAOYSA-N.
| Molecular formula | C13H14O2 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl 4-ethynylbenzoate |
| InChIKey | FWAUARVBLKIMRS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)C#C |
Computed by PubChem (NCBI)