Products 1113-04-8

CAS 1113-04-8 is the registry number for N-Ethyl-2-hydroxy-N,N-dimethylethan-1-aminium iodide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl-(2-hydroxyethyl)-dimethylazanium iodide (CAS 1113-04-8) is a chemical compound with the molecular formula C6H16INO and a molecular weight of 245.10 g/mol. IUPAC name: ethyl-(2-hydroxyethyl)-dimethylazanium iodide. InChIKey: IVCGCSKCNKPTOM-UHFFFAOYSA-M.

Identity
Molecular formulaC6H16INO
Molecular weight245.10 g/mol
IUPAC nameethyl-(2-hydroxyethyl)-dimethylazanium iodide
InChIKeyIVCGCSKCNKPTOM-UHFFFAOYSA-M
SMILESCC[N+](C)(C)CCO.[I-]

Computed by PubChem (NCBI)