Products 60154-19-0

CAS 60154-19-0 is the registry number for beta-Methylcholine Iodide, ≥99%, ≥99%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2-hydroxypropyl(trimethyl)azanium iodide (CAS 60154-19-0) is a chemical compound with the molecular formula C6H16INO and a molecular weight of 245.10 g/mol. IUPAC name: 2-hydroxypropyl(trimethyl)azanium iodide. InChIKey: FOILINVEQJRMPF-UHFFFAOYSA-M.

Identity
Molecular formulaC6H16INO
Molecular weight245.10 g/mol
IUPAC name2-hydroxypropyl(trimethyl)azanium iodide
InChIKeyFOILINVEQJRMPF-UHFFFAOYSA-M
SMILESCC(C[N+](C)(C)C)O.[I-]

Computed by PubChem (NCBI)