Products 1114-00-7
CAS 1114-00-7 is the registry number for (±)-2,3-Dibromosuccinic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R)-2,3-dibromobutanedioic acid (CAS 1114-00-7) is a chemical compound with the molecular formula C4H4Br2O4 and a molecular weight of 275.88 g/mol. IUPAC name: (2R,3R)-2,3-dibromobutanedioic acid. InChIKey: FJWGRXKOBIVTFA-LWMBPPNESA-N.
| Molecular formula | C4H4Br2O4 |
|---|---|
| Molecular weight | 275.88 g/mol |
| IUPAC name | (2R,3R)-2,3-dibromobutanedioic acid |
| InChIKey | FJWGRXKOBIVTFA-LWMBPPNESA-N |
| SMILES | [C@H]([C@@H](C(=O)O)Br)(C(=O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
rel-(2R,3R)-2,3-Dibromobutanedioic acid, 2,3-Dibromosuccinic acid, (2R,3R)-, (2R,3R)-2,3-dibromobutanedioic acid, Butanedioic acid, 2,3-dibromo-, (2R,3R)-, (+/-)-2,3-dibromosuccinic acid, C4H4Br2O4, NCIStruc1_000909, NCIStruc2_001629, FJWGRXKOBIVTFA-LWMBPPNESA-N, (2R,3R)-2,3-dibromosuccinic acid