CAS 608-36-6 appears in our catalog under these names: Meso-2,3-dibromosuccinic acid, 98%, meso–2,3–Dibromosuccinic acid, meso-2,3-Dibromosuccinic Acid, >98.0%(T), (2R,3S)-rel-2,3-Dibromosuccinic acid 98%, meso-2,3-Dibromosuccinic acid, 97%. Offered by: Combi-blocks, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 5g, 500g, 100g, 25g.
(2S,3R)-2,3-dibromobutanedioic acid (CAS 608-36-6) is a chemical compound with the molecular formula C4H4Br2O4 and a molecular weight of 275.88 g/mol. IUPAC name: (2S,3R)-2,3-dibromobutanedioic acid. InChIKey: FJWGRXKOBIVTFA-XIXRPRMCSA-N.
| Molecular formula | C4H4Br2O4 |
|---|---|
| Molecular weight | 275.88 g/mol |
| IUPAC name | (2S,3R)-2,3-dibromobutanedioic acid |
| InChIKey | FJWGRXKOBIVTFA-XIXRPRMCSA-N |
| SMILES | [C@@H]([C@@H](C(=O)O)Br)(C(=O)O)Br |
Computed by PubChem (NCBI)