Products 1114-94-9
CAS 1114-94-9 appears in our catalog under these names: H–D–Ala–D–Ala–D–Ala–OH, H-D-Ala-D-Ala-D-Ala-OH, D-{Ala-Ala-Ala}. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 250mg, 1000mg, 500mg, 2000mg, Get quote.
(2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoic acid (CAS 1114-94-9) is a chemical compound with the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. IUPAC name: (2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoic acid. InChIKey: BYXHQQCXAJARLQ-HSUXUTPPSA-N.
| Molecular formula | C9H17N3O4 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (2R)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]propanoyl]amino]propanoic acid |
| InChIKey | BYXHQQCXAJARLQ-HSUXUTPPSA-N |
| SMILES | C[C@H](C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)O)N |
Computed by PubChem (NCBI)