Products 1114491-60-9
CAS 1114491-60-9 appears in our catalog under these names: Axinysone B, Axinysone B, ≥98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 25mg, 10mg, 50mg, 10 mg, 1 mg, 5 mg, 5mg.
(1aS,4R,7S,7aS,7bR)-4-hydroxy-1,1,7,7a-tetramethyl-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-2-one (CAS 1114491-60-9) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: (1aS,4R,7S,7aS,7bR)-4-hydroxy-1,1,7,7a-tetramethyl-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-2-one. InChIKey: KDPNSOLPHGZUAY-RHVNPFLSSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | (1aS,4R,7S,7aS,7bR)-4-hydroxy-1,1,7,7a-tetramethyl-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-2-one |
| InChIKey | KDPNSOLPHGZUAY-RHVNPFLSSA-N |
| SMILES | C[C@H]1CC[C@H](C2=CC(=O)[C@H]3[C@@H]([C@]12C)C3(C)C)O |
Computed by PubChem (NCBI)
Synonyms:
axinysone B, orb1681352