CAS 111478-84-3 appears in our catalog under these names: 1,8-Diethyl-1,3,4,9-tetrahydro-4-oxo-pyrano[3,4-b]indole-1-acetic acid methyl ester, 98%, Etodolac Impurity 17, 1,8-Diethyl-1,3,4,9-tetrahydro-4-oxo-pyrano(3,4-b)indole-1-acetic Acid Methyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 5mg.
Methyl 2-(1,8-diethyl-4-oxo-9H-pyrano[3,4-b]indol-1-yl)acetate (CAS 111478-84-3) is a chemical compound with the molecular formula C18H21NO4 and a molecular weight of 315.4 g/mol. IUPAC name: methyl 2-(1,8-diethyl-4-oxo-9H-pyrano[3,4-b]indol-1-yl)acetate. InChIKey: NPOCOYDGCIJCKR-UHFFFAOYSA-N.
| Molecular formula | C18H21NO4 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | methyl 2-(1,8-diethyl-4-oxo-9H-pyrano[3,4-b]indol-1-yl)acetate |
| InChIKey | NPOCOYDGCIJCKR-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C3=C(N2)C(OCC3=O)(CC)CC(=O)OC |
Computed by PubChem (NCBI)