CAS 500789-00-4 appears in our catalog under these names: (R)-3-((tert-Butoxycarbonyl)amino)-3-(naphthalen-1-yl)propanoic acid, 95%, Boc-(R)-3-Amino-3-(1-naphthyl)-propionic acid, (R)-3-((tert-Butoxycarbonyl)amino)-3-(naphthalen-1-yl)propanoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 5g.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-naphthalen-1-ylpropanoic acid (CAS 500789-00-4) is a chemical compound with the molecular formula C18H21NO4 and a molecular weight of 315.4 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-naphthalen-1-ylpropanoic acid. InChIKey: YDSAGJMVVUBPOK-OAHLLOKOSA-N.
| Molecular formula | C18H21NO4 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-naphthalen-1-ylpropanoic acid |
| InChIKey | YDSAGJMVVUBPOK-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)