Products 1115-63-5
CAS 1115-63-5 appears in our catalog under these names: L-Aspartic acid potassium salt, 95%, L-Aspartic acid potasium salt/ 100%, L–Aspartic acid potassium, L-Aspartic acid potassium, Potassium L-Aspartate, >97.0%(T). Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 100g, 500g, 1kg, 5g, 25g, 100mg, 500mg, 5kg.
Potassium (2S)-2-amino-4-hydroxy-4-oxobutanoate (CAS 1115-63-5) is a chemical compound with the molecular formula C4H6KNO4 and a molecular weight of 171.19 g/mol. IUPAC name: potassium (2S)-2-amino-4-hydroxy-4-oxobutanoate. InChIKey: TXXVQZSTAVIHFD-DKWTVANSSA-M.
| Molecular formula | C4H6KNO4 |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | potassium (2S)-2-amino-4-hydroxy-4-oxobutanoate |
| InChIKey | TXXVQZSTAVIHFD-DKWTVANSSA-M |
| SMILES | C([C@@H](C(=O)[O-])N)C(=O)O.[K+] |
Computed by PubChem (NCBI)
Synonyms:
monopotassium aspartate, L-Aspartic acid, monopotassium salt, Potassium aspartate anhydrous, L-Aspartic acid potassium salt, Potassium L-aspartate, Potassium hydrogen aspartate, L-Aspartic acid (potassium), potassium;(2S)-2-amino-4-hydroxy-4-oxobutanoate, L-aspartic acid monopotassium salt, PotassiuM L-Aspartate Hydrate