CAS 1461707-39-0 appears in our catalog under these names: Potassium 3-carbamoyl-3-hydroxypropanoate, 95%, Potassium 3-carbamoyl-3-hydroxypropanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Potassium 4-amino-3-hydroxy-4-oxobutanoate (CAS 1461707-39-0) is a chemical compound with the molecular formula C4H6KNO4 and a molecular weight of 171.19 g/mol. IUPAC name: potassium 4-amino-3-hydroxy-4-oxobutanoate. InChIKey: BZVWIGPCQZSKSA-UHFFFAOYSA-M.
| Molecular formula | C4H6KNO4 |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | potassium 4-amino-3-hydroxy-4-oxobutanoate |
| InChIKey | BZVWIGPCQZSKSA-UHFFFAOYSA-M |
| SMILES | C(C(C(=O)N)O)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)