CAS 1115640-18-0 appears in our catalog under these names: 4–Phenyldibenzothiophene–6–boronic acid, (6-Phenyldibenzo[b,d]thiophen-4-yl)boronic acid, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
(6-phenyldibenzothiophen-4-yl)boronic acid (CAS 1115640-18-0) is a chemical compound with the molecular formula C18H13BO2S and a molecular weight of 304.2 g/mol. IUPAC name: (6-phenyldibenzothiophen-4-yl)boronic acid. InChIKey: CERRROIEYSGXNN-UHFFFAOYSA-N.
| Molecular formula | C18H13BO2S |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | (6-phenyldibenzothiophen-4-yl)boronic acid |
| InChIKey | CERRROIEYSGXNN-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C3=C(S2)C(=CC=C3)C4=CC=CC=C4)(O)O |
Computed by PubChem (NCBI)