CAS 1307859-67-1 appears in our catalog under these names: (3-(Dibenzo[b,d]thiophen-4-yl)phenyl)boronic acid, 95%, (3-(Dibenzo[b,d]thiophen-4-yl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg.
(3-dibenzothiophen-4-ylphenyl)boronic acid (CAS 1307859-67-1) is a chemical compound with the molecular formula C18H13BO2S and a molecular weight of 304.2 g/mol. IUPAC name: (3-dibenzothiophen-4-ylphenyl)boronic acid. InChIKey: NLOHUARANQHPPJ-UHFFFAOYSA-N.
| Molecular formula | C18H13BO2S |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | (3-dibenzothiophen-4-ylphenyl)boronic acid |
| InChIKey | NLOHUARANQHPPJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CC=CC3=C2SC4=CC=CC=C34)(O)O |
Computed by PubChem (NCBI)