Products 1116478-16-0
CAS 1116478-16-0 is the registry number for tert-Butyl (2S,3R)-1-benzyl-3-((benzyloxy)methyl)azetidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S,3R)-1-benzyl-3-(phenylmethoxymethyl)azetidine-2-carboxylate (CAS 1116478-16-0) is a chemical compound with the molecular formula C23H29NO3 and a molecular weight of 367.5 g/mol. IUPAC name: tert-butyl (2S,3R)-1-benzyl-3-(phenylmethoxymethyl)azetidine-2-carboxylate. InChIKey: ZPUQPHSMCCWGCD-SFTDATJTSA-N.
| Molecular formula | C23H29NO3 |
|---|---|
| Molecular weight | 367.5 g/mol |
| IUPAC name | tert-butyl (2S,3R)-1-benzyl-3-(phenylmethoxymethyl)azetidine-2-carboxylate |
| InChIKey | ZPUQPHSMCCWGCD-SFTDATJTSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1[C@@H](CN1CC2=CC=CC=C2)COCC3=CC=CC=C3 |
Computed by PubChem (NCBI)