Products 1794737-45-3
CAS 1794737-45-3 is the registry number for Fenbutrazate-d4. Offered by: TRC. Available pack sizes: 250mg.
[1,1,2,2-tetradeuterio-2-(3-methyl-2-phenylmorpholin-4-yl)ethyl] 2-phenylbutanoate (CAS 1794737-45-3) is a chemical compound with the molecular formula C23H29NO3 and a molecular weight of 371.5 g/mol. IUPAC name: [1,1,2,2-tetradeuterio-2-(3-methyl-2-phenylmorpholin-4-yl)ethyl] 2-phenylbutanoate. InChIKey: BAQKJENAVQLANS-XLBLAKOUSA-N.
| Molecular formula | C23H29NO3 |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | [1,1,2,2-tetradeuterio-2-(3-methyl-2-phenylmorpholin-4-yl)ethyl] 2-phenylbutanoate |
| InChIKey | BAQKJENAVQLANS-XLBLAKOUSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OC(=O)C(CC)C1=CC=CC=C1)N2CCOC(C2C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)