CAS 111687-79-7 is the registry number for Methyl (1R,3S)-1-ethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (1R,3S)-1-ethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (CAS 111687-79-7) is a chemical compound with the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. IUPAC name: methyl (1R,3S)-1-ethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate. InChIKey: ADIHMVQHJFGVMN-YPMHNXCESA-N.
| Molecular formula | C15H18N2O2 |
|---|---|
| Molecular weight | 258.32 g/mol |
| IUPAC name | methyl (1R,3S)-1-ethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| InChIKey | ADIHMVQHJFGVMN-YPMHNXCESA-N |
| SMILES | CC[C@@H]1C2=C(C[C@H](N1)C(=O)OC)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)