Products 111771-08-5
CAS 111771-08-5 appears in our catalog under these names: 2–Fluoro–6–iodobenzoic Acid, 2-Fluoro-6-iodobenzoic acid, 97% , 2-Fluoro-6-iodobenzoic Acid, >98.0%(GC)(T), 2-Fluoro-6-iodobenzoic acid 98%, 2-FLUORO-6-IODOBENZOIC ACID, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 50g, 250g, 500g.
2-fluoro-6-iodobenzoic acid (CAS 111771-08-5) is a chemical compound with the molecular formula C7H4FIO2 and a molecular weight of 266.01 g/mol. IUPAC name: 2-fluoro-6-iodobenzoic acid. InChIKey: CYCXAPWOBWWNRK-UHFFFAOYSA-N.
| Molecular formula | C7H4FIO2 |
|---|---|
| Molecular weight | 266.01 g/mol |
| IUPAC name | 2-fluoro-6-iodobenzoic acid |
| InChIKey | CYCXAPWOBWWNRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)C(=O)O)F |
Computed by PubChem (NCBI)