CAS 387-48-4 appears in our catalog under these names: 3-Fluoro-2-iodobenzoic acid 98%, 3-fluoro-2-iodobenzoic acid, 98%, 98%, 3-Fluoro-2-iodobenzoic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
3-fluoro-2-iodobenzoic acid (CAS 387-48-4) is a chemical compound with the molecular formula C7H4FIO2 and a molecular weight of 266.01 g/mol. IUPAC name: 3-fluoro-2-iodobenzoic acid. InChIKey: CXPLPVNWMLRKTO-UHFFFAOYSA-N.
| Molecular formula | C7H4FIO2 |
|---|---|
| Molecular weight | 266.01 g/mol |
| IUPAC name | 3-fluoro-2-iodobenzoic acid |
| InChIKey | CXPLPVNWMLRKTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)I)C(=O)O |
Computed by PubChem (NCBI)