CAS 111771-57-4 appears in our catalog under these names: Boc-D-Phe(4-B)-OH 98%, (R)-3-(4-Boronophenyl)-2-((tert-butoxycarbonyl)amino)propanoic acid, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-3-(4-boronophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 111771-57-4) is a chemical compound with the molecular formula C14H20BNO6 and a molecular weight of 309.12 g/mol. IUPAC name: (2R)-3-(4-boronophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: SGRRXMOSJYUMBY-LLVKDONJSA-N.
| Molecular formula | C14H20BNO6 |
|---|---|
| Molecular weight | 309.12 g/mol |
| IUPAC name | (2R)-3-(4-boronophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | SGRRXMOSJYUMBY-LLVKDONJSA-N |
| SMILES | B(C1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)