CAS 266999-35-3 appears in our catalog under these names: Boc-d, l-phe[4-b(oh)2], 95%, 2–((t–butoxycarbonyl) amino)–3–(4–(dihydroxyboranyl) phenyl) propionic acid, 2-[(t-Butoxycarbonyl)amino]-3-[4-(dihydroxyboranyl)phenyl]propionic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
3-(4-boronophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 266999-35-3) is a chemical compound with the molecular formula C14H20BNO6 and a molecular weight of 309.12 g/mol. IUPAC name: 3-(4-boronophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: SGRRXMOSJYUMBY-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO6 |
|---|---|
| Molecular weight | 309.12 g/mol |
| IUPAC name | 3-(4-boronophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | SGRRXMOSJYUMBY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CC(C(=O)O)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)