Products 111843-10-8
CAS 111843-10-8 appears in our catalog under these names: Hancinone C, Hancinone C, Hancinone C, ≥95%, Hancinone C, 96.5%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg, 20mg.
4,5-dimethoxy-2-prop-2-enyl-4-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]cyclohexa-2,5-dien-1-one (CAS 111843-10-8) is a chemical compound with the molecular formula C23H28O6 and a molecular weight of 400.5 g/mol. IUPAC name: 4,5-dimethoxy-2-prop-2-enyl-4-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]cyclohexa-2,5-dien-1-one. InChIKey: LNCSXXRCEFAYFK-XNTDXEJSSA-N.
| Molecular formula | C23H28O6 |
|---|---|
| Molecular weight | 400.5 g/mol |
| IUPAC name | 4,5-dimethoxy-2-prop-2-enyl-4-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]cyclohexa-2,5-dien-1-one |
| InChIKey | LNCSXXRCEFAYFK-XNTDXEJSSA-N |
| SMILES | C/C(=C\C1=CC(=C(C(=C1)OC)OC)OC)/C2(C=C(C(=O)C=C2OC)CC=C)OC |
Computed by PubChem (NCBI)
Synonyms:
Hancinone C, orb1682453