CAS 111864-25-6 appears in our catalog under these names: 2-(Diphenylphosphino)benzenesulfonic acid 97%, Benzenesulfonic acid, 2-(diphenylphosphino)-, 97%, 97%, 2-(DIPHENYLPHOSPHINO)BENZENESULFONIC AC&. Offered by: Ambeed, Chemat, Sigma-Aldrich. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-diphenylphosphanylbenzenesulfonic acid (CAS 111864-25-6) is a chemical compound with the molecular formula C18H15O3PS and a molecular weight of 342.3 g/mol. IUPAC name: 2-diphenylphosphanylbenzenesulfonic acid. InChIKey: HXVJDHROZFWXHT-UHFFFAOYSA-N.
| Molecular formula | C18H15O3PS |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 2-diphenylphosphanylbenzenesulfonic acid |
| InChIKey | HXVJDHROZFWXHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3S(=O)(=O)O |
Computed by PubChem (NCBI)