Products 16704-71-5

CAS 16704-71-5 is the registry number for 3-(Diphenylphosphino)benzenesulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-diphenylphosphanylbenzenesulfonic acid (CAS 16704-71-5) is a chemical compound with the molecular formula C18H15O3PS and a molecular weight of 342.3 g/mol. IUPAC name: 3-diphenylphosphanylbenzenesulfonic acid. InChIKey: ITPOKAFWZBFZCV-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15O3PS
Molecular weight342.3 g/mol
IUPAC name3-diphenylphosphanylbenzenesulfonic acid
InChIKeyITPOKAFWZBFZCV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC(=CC=C3)S(=O)(=O)O

Computed by PubChem (NCBI)