Products 111869-49-9
CAS 111869-49-9 appears in our catalog under these names: 7-Deaza-2',3'-dideoxyguanosine, 95%, 7–Deaza–2'，3'–dideoxyguanosine, 7–Deaza–2',3'–dideoxyguanosine, 7-Deaza-2',3'-dideoxyguanosine, 7-Deaza-2',3'-dideoxyguanosine, 98.02%. Offered by: Combi-blocks, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 1g, 10mg, 5mg, 25mg, 50mg, 5 mg, 10 mg.
2-amino-7-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one (CAS 111869-49-9) is a chemical compound with the molecular formula C11H14N4O3 and a molecular weight of 250.25 g/mol. IUPAC name: 2-amino-7-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one. InChIKey: IRKZBFORRGBSAO-POYBYMJQSA-N.
| Molecular formula | C11H14N4O3 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 2-amino-7-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| InChIKey | IRKZBFORRGBSAO-POYBYMJQSA-N |
| SMILES | C1C[C@@H](O[C@@H]1CO)N2C=CC3=C2N=C(NC3=O)N |
Computed by PubChem (NCBI)