Products 1176706-58-3
CAS 1176706-58-3 is the registry number for N-(2-Aminoethyl)-2-(2,3-dihydro-3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
N-(2-aminoethyl)-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide (CAS 1176706-58-3) is a chemical compound with the molecular formula C11H14N4O3 and a molecular weight of 250.25 g/mol. IUPAC name: N-(2-aminoethyl)-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide. InChIKey: QLEVDQQKNUNUAR-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O3 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | N-(2-aminoethyl)-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide |
| InChIKey | QLEVDQQKNUNUAR-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=C(O1)C=CC=N2)CC(=O)NCCN |
Computed by PubChem (NCBI)