CAS 1118787-06-6 is the registry number for N-{1-(5-(3-Bromophenyl)thiophen-2-yl)ethylidene}hydroxylamine, somers. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
(NE)-N-[1-[5-(3-bromophenyl)thiophen-2-yl]ethylidene]hydroxylamine (CAS 1118787-06-6) is a chemical compound with the molecular formula C12H10BrNOS and a molecular weight of 296.18 g/mol. IUPAC name: (NE)-N-[1-[5-(3-bromophenyl)thiophen-2-yl]ethylidene]hydroxylamine. InChIKey: CDOPOEQLJGROKQ-RIYZIHGNSA-N.
| Molecular formula | C12H10BrNOS |
|---|---|
| Molecular weight | 296.18 g/mol |
| IUPAC name | (NE)-N-[1-[5-(3-bromophenyl)thiophen-2-yl]ethylidene]hydroxylamine |
| InChIKey | CDOPOEQLJGROKQ-RIYZIHGNSA-N |
| SMILES | C/C(=N\O)/C1=CC=C(S1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)