CAS 7520-95-8 is the registry number for 2-Bromo-1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)-1-ethanone, 90% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g, 5g.
2-bromo-1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone (CAS 7520-95-8) is a chemical compound with the molecular formula C12H10BrNOS and a molecular weight of 296.18 g/mol. IUPAC name: 2-bromo-1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone. InChIKey: BOMSILGSXFNLJX-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNOS |
|---|---|
| Molecular weight | 296.18 g/mol |
| IUPAC name | 2-bromo-1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone |
| InChIKey | BOMSILGSXFNLJX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=C2)C(=O)CBr |
Computed by PubChem (NCBI)