Products 1118788-24-1
CAS 1118788-24-1 appears in our catalog under these names: 4-Chloro-6-methyl-2-(3-nitrophenyl)pyrimidine, 95%, 4-Chloro-6-methyl-2-(3-nitrophenyl)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-chloro-6-methyl-2-(3-nitrophenyl)pyrimidine (CAS 1118788-24-1) is a chemical compound with the molecular formula C11H8ClN3O2 and a molecular weight of 249.65 g/mol. IUPAC name: 4-chloro-6-methyl-2-(3-nitrophenyl)pyrimidine. InChIKey: NXSVTABWELHVGK-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN3O2 |
|---|---|
| Molecular weight | 249.65 g/mol |
| IUPAC name | 4-chloro-6-methyl-2-(3-nitrophenyl)pyrimidine |
| InChIKey | NXSVTABWELHVGK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)C2=CC(=CC=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)